C16H15Cl2N7O — CID 135509558
2-amino-5-[3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]propyl]-4-phenyl-1H-pyrimidin-6-one (PubChem CID 135509558) has the molecular formula C16H15Cl2N7O and a molecular weight of 392.25 g/mol. Its IUPAC name is 2-amino-5-[3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]propyl]-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 2-amino-5-[3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]propyl]-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135509558 |
| Molecular Formula | C16H15Cl2N7O |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-amino-5-[3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]propyl]-4-phenyl-1H-pyrimidin-6-one |
| SMILES | Nc1nc(-c2ccccc2)c(CCCNc2nc(Cl)nc(Cl)n2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H15Cl2N7O/c17-13-23-14(18)25-16(24-13)20-8-4-7-10-11(9-5-2-1-3-6-9)21-15(19)22-12(10)26/h1-3,5-6H,4,7-8H2,(H3,19,21,22,26)(H,20,23,24,25) |
| InChIKey | JSIXYTIGROTHMV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|