C19H16Cl4N4O4 — CID 135509603
N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-N'-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]pentanediamide (PubChem CID 135509603) has the molecular formula C19H16Cl4N4O4 and a molecular weight of 506.17 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-N'-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]pentanediamide.
| Compound Name | N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-N'-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 135509603 |
| Molecular Formula | C19H16Cl4N4O4 |
| Molecular Weight | 506.17 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-N'-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)N/N=C/c1cc(Cl)cc(Cl)c1O)N/N=C\c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H16Cl4N4O4/c20-12-4-10(18(30)14(22)6-12)8-24-26-16(28)2-1-3-17(29)27-25-9-11-5-13(21)7-15(23)19(11)31/h4-9,30-31H,1-3H2,(H,26,28)(H,27,29)/b24-8-,25-9+ |
| InChIKey | LOZXLJLDVPBUOC-FYKLILKISA-N |
| XLogP | 4.48 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|