C15H28N2O4Si — CID 135509828
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-diazo-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-one (PubChem CID 135509828) has the molecular formula C15H28N2O4Si and a molecular weight of 328.49 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-diazo-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-diazo-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-one |
|---|---|
| PubChem CID | 135509828 |
| Molecular Formula | C15H28N2O4Si |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-diazo-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-one |
| SMILES | CC(=O)C(=[N+]=[N-])[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H28N2O4Si/c1-10(18)12(17-16)13(11-9-19-15(5,6)20-11)21-22(7,8)14(2,3)4/h11,13H,9H2,1-8H3/t11-,13-/m1/s1 |
| InChIKey | UWIHFVRPABALMS-DGCLKSJQSA-N |
| XLogP | 2.79 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|