C25H27ClN4O6S — CID 135509855
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]oxane-2,4-dione (PubChem CID 135509855) has the molecular formula C25H27ClN4O6S and a molecular weight of 547.03 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 135509855 |
| Molecular Formula | C25H27ClN4O6S |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6-oxo-1,7-dihydropurin-8-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3nc4nc[nH]c(=O)c4[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C25H27ClN4O6S/c1-34-17-10-18(35-2)15(26)9-13(17)7-8-25(14-5-3-4-6-14)11-16(31)20(23(33)36-25)37-24-29-19-21(30-24)27-12-28-22(19)32/h9-10,12,14,20H,3-8,11H2,1-2H3,(H2,27,28,29,30,32) |
| InChIKey | WBTUHXZRWUMJSS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|