C25H39N4O9PS2 — CID 135509871
S-[2-[[(2S,4R,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 135509871) has the molecular formula C25H39N4O9PS2 and a molecular weight of 634.71 g/mol. Its IUPAC name is S-[2-[[(2S,4R,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2S,4R,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 135509871 |
| Molecular Formula | C25H39N4O9PS2 |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | S-[2-[[(2S,4R,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OCCSC(=O)C(C)(C)C)OC[C@@H]1C[C@@H](O)[C@H](n2ccc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C25H39N4O9PS2/c1-24(2,3)21(32)40-11-9-35-39(34,36-10-12-41-22(33)25(4,5)6)37-14-15-13-17(30)20(38-15)29-8-7-16-18(29)27-23(26)28-19(16)31/h7-8,15,17,20,30H,9-14H2,1-6H3,(H3,26,27,28,31)/t15-,17+,20+/m0/s1 |
| InChIKey | VMKMZWQVNIPHFN-XAUMDUMWSA-N |
| XLogP | 3.72 |
| TPSA | 185.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|