C25H24N4O2 — CID 135510061
N'-[(E)-(2-phenyl-2,3-dihydro-1H-quinolin-4-ylidene)amino]-N-(1-phenylethyl)oxamide (PubChem CID 135510061) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N'-[(E)-(2-phenyl-2,3-dihydro-1H-quinolin-4-ylidene)amino]-N-(1-phenylethyl)oxamide.
| Compound Name | N'-[(E)-(2-phenyl-2,3-dihydro-1H-quinolin-4-ylidene)amino]-N-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 135510061 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N'-[(E)-(2-phenyl-2,3-dihydro-1H-quinolin-4-ylidene)amino]-N-(1-phenylethyl)oxamide |
| SMILES | CC(NC(=O)C(=O)N/N=C1\CC(c2ccccc2)Nc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H24N4O2/c1-17(18-10-4-2-5-11-18)26-24(30)25(31)29-28-23-16-22(19-12-6-3-7-13-19)27-21-15-9-8-14-20(21)23/h2-15,17,22,27H,16H2,1H3,(H,26,30)(H,29,31)/b28-23+ |
| InChIKey | KSMXVBWVKOAUPU-WEMUOSSPSA-N |
| XLogP | 3.94 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|