About 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea
1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 135510251) has the molecular formula C14H20N4O3S
and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
Molecular Properties
| Compound Name | 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| PubChem CID | 135510251 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Oc1ccc(/C=N/NC(=S)NCCN2CCOCC2)c(O)c1 |
| InChI | InChI=1S/C14H20N4O3S/c19-12-2-1-11(13(20)9-12)10-16-17-14(22)15-3-4-18-5-7-21-8-6-18/h1-2,9-10,19-20H,3-8H2,(H2,15,17,22)/b16-10+ |
| InChIKey | CYBFZQOVBPAXGO-MHWRWJLKSA-N |
| XLogP | 0.23 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea?
The IUPAC name of 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (CID 135510251) is 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
What is the SMILES notation for 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea?
The canonical SMILES for 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea is Oc1ccc(/C=N/NC(=S)NCCN2CCOCC2)c(O)c1.
What is the InChIKey of 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea?
The InChIKey is CYBFZQOVBPAXGO-MHWRWJLKSA-N. The full InChI is InChI=1S/C14H20N4O3S/c19-12-2-1-11(13(20)9-12)10-16-17-14(22)15-3-4-18-5-7-21-8-6-18/h1-2,9-10,19-20H,3-8H2,(H2,15,17,22)/b16-10+.
What are the key properties of 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea?
1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea has a molecular weight of 324.41 g/mol, XLogP of 0.23, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea is sourced from PubChem (CID 135510251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).