About N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide
N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide (PubChem CID 135510253) has the molecular formula C10H11N3O4
and a molecular weight of 237.22 g/mol. Its IUPAC name is N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide.
Molecular Properties
| Compound Name | N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide |
| PubChem CID | 135510253 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide |
| SMILES | C/C(=N\NC(=O)C(N)=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H11N3O4/c1-5(12-13-10(17)9(11)16)7-3-2-6(14)4-8(7)15/h2-4,14-15H,1H3,(H2,11,16)(H,13,17)/b12-5+ |
| InChIKey | FFNDIGNUTOLLPP-LFYBBSHMSA-N |
| XLogP | -0.58 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide?
The IUPAC name of N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide (CID 135510253) is N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide.
What is the SMILES notation for N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide?
The canonical SMILES for N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide is C/C(=N\NC(=O)C(N)=O)c1ccc(O)cc1O.
What is the InChIKey of N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide?
The InChIKey is FFNDIGNUTOLLPP-LFYBBSHMSA-N. The full InChI is InChI=1S/C10H11N3O4/c1-5(12-13-10(17)9(11)16)7-3-2-6(14)4-8(7)15/h2-4,14-15H,1H3,(H2,11,16)(H,13,17)/b12-5+.
What are the key properties of N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide?
N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide has a molecular weight of 237.22 g/mol, XLogP of -0.58, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]oxamide is sourced from PubChem (CID 135510253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).