C10H8N6O3 — CID 135510405
1,3-dimethyl-8H-pyrimido[4,5-g]pteridine-2,4,9-trione (PubChem CID 135510405) has the molecular formula C10H8N6O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is 1,3-dimethyl-8H-pyrimido[4,5-g]pteridine-2,4,9-trione.
| Compound Name | 1,3-dimethyl-8H-pyrimido[4,5-g]pteridine-2,4,9-trione |
|---|---|
| PubChem CID | 135510405 |
| Molecular Formula | C10H8N6O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1,3-dimethyl-8H-pyrimido[4,5-g]pteridine-2,4,9-trione |
| SMILES | Cn1c(=O)c2nc3nc[nH]c(=O)c3nc2n(C)c1=O |
| InChI | InChI=1S/C10H8N6O3/c1-15-7-5(9(18)16(2)10(15)19)13-6-4(14-7)8(17)12-3-11-6/h3H,1-2H3,(H,11,12,13,17) |
| InChIKey | AVDHPOWFUFYJBV-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|