C14H16Cl2O3 — CID 135510648
2-[(1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 135510648) has the molecular formula C14H16Cl2O3 and a molecular weight of 303.19 g/mol. Its IUPAC name is 2-[(1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[(1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135510648 |
| Molecular Formula | C14H16Cl2O3 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-[(1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)C1=C(O)CCCC1=O |
| InChI | InChI=1S/C14H16Cl2O3/c1-14(2)7(6-10(15)16)12(14)13(19)11-8(17)4-3-5-9(11)18/h6-7,12,17H,3-5H2,1-2H3/t7-,12+/m0/s1 |
| InChIKey | YBVGIZYVJKEWSI-JVXZTZIISA-N |
| XLogP | 3.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|