About 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one
2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one (PubChem CID 135510702) has the molecular formula C10H9N2O+
and a molecular weight of 173.19 g/mol. Its IUPAC name is 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one.
Molecular Properties
| Compound Name | 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one |
| PubChem CID | 135510702 |
| Molecular Formula | C10H9N2O+ |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one |
| SMILES | N=C=C1CC[n+]2ccccc2C1=O |
| InChI | InChI=1S/C10H9N2O/c11-7-8-4-6-12-5-2-1-3-9(12)10(8)13/h1-3,5,11H,4,6H2/q+1 |
| InChIKey | POOIQEZZOYBYLY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 44.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one?
The IUPAC name of 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one (CID 135510702) is 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one.
What is the SMILES notation for 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one?
The canonical SMILES for 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one is N=C=C1CC[n+]2ccccc2C1=O.
What is the InChIKey of 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one?
The InChIKey is POOIQEZZOYBYLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N2O/c11-7-8-4-6-12-5-2-1-3-9(12)10(8)13/h1-3,5,11H,4,6H2/q+1.
What are the key properties of 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one?
2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one has a molecular weight of 173.19 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iminomethylidene)-3,4-dihydroquinolizin-5-ium-1-one is sourced from PubChem (CID 135510702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).