C9H7Cl2N5O2 — CID 135510786
4-amino-N'-(3,5-dichlorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135510786) has the molecular formula C9H7Cl2N5O2 and a molecular weight of 288.09 g/mol. Its IUPAC name is 4-amino-N'-(3,5-dichlorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-(3,5-dichlorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135510786 |
| Molecular Formula | C9H7Cl2N5O2 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 4-amino-N'-(3,5-dichlorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Nc1nonc1/C(=N/c1cc(Cl)cc(Cl)c1)NO |
| InChI | InChI=1S/C9H7Cl2N5O2/c10-4-1-5(11)3-6(2-4)13-9(14-17)7-8(12)16-18-15-7/h1-3,17H,(H2,12,16)(H,13,14) |
| InChIKey | MAMOXKQKRUDXBH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|