C13H19N5O2 — CID 135510901
1-[4-amino-2-[(E)-hydroxyiminomethyl]-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-2-methylpropan-2-ol (PubChem CID 135510901) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-[4-amino-2-[(E)-hydroxyiminomethyl]-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-amino-2-[(E)-hydroxyiminomethyl]-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 135510901 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[4-amino-2-[(E)-hydroxyiminomethyl]-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]-2-methylpropan-2-ol |
| SMILES | Cc1nc(N)c2nc(/C=N/O)n(CC(C)(C)O)c2c1C |
| InChI | InChI=1S/C13H19N5O2/c1-7-8(2)16-12(14)10-11(7)18(6-13(3,4)19)9(17-10)5-15-20/h5,19-20H,6H2,1-4H3,(H2,14,16)/b15-5+ |
| InChIKey | OKBGOAPZBNKWRC-PJQLUOCWSA-N |
| XLogP | 1.21 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|