About 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one
2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one (PubChem CID 135511119) has the molecular formula C12H12N4O
and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one.
Molecular Properties
| Compound Name | 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one |
| PubChem CID | 135511119 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one |
| SMILES | CN(C)c1nc2c([nH]c3ccccc32)c(=O)[nH]1 |
| InChI | InChI=1S/C12H12N4O/c1-16(2)12-14-9-7-5-3-4-6-8(7)13-10(9)11(17)15-12/h3-6,13H,1-2H3,(H,14,15,17) |
| InChIKey | FVUOLFVHQBEYMA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one?
The IUPAC name of 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one (CID 135511119) is 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one.
What is the SMILES notation for 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one?
The canonical SMILES for 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one is CN(C)c1nc2c([nH]c3ccccc32)c(=O)[nH]1.
What is the InChIKey of 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one?
The InChIKey is FVUOLFVHQBEYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O/c1-16(2)12-14-9-7-5-3-4-6-8(7)13-10(9)11(17)15-12/h3-6,13H,1-2H3,(H,14,15,17).
What are the key properties of 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one?
2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one has a molecular weight of 228.25 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-3,5-dihydropyrimido[5,4-b]indol-4-one is sourced from PubChem (CID 135511119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).