C14H16N2OS2 — CID 135511209
2-cyclopentylsulfanyl-4-(thiophen-3-ylmethyl)-1H-pyrimidin-6-one (PubChem CID 135511209) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-4-(thiophen-3-ylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopentylsulfanyl-4-(thiophen-3-ylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135511209 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-cyclopentylsulfanyl-4-(thiophen-3-ylmethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(Cc2ccsc2)nc(SC2CCCC2)[nH]1 |
| InChI | InChI=1S/C14H16N2OS2/c17-13-8-11(7-10-5-6-18-9-10)15-14(16-13)19-12-3-1-2-4-12/h5-6,8-9,12H,1-4,7H2,(H,15,16,17) |
| InChIKey | LMJNHRJROXEBCG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |