About 1-methylisoquinoline-6,7-diol
1-methylisoquinoline-6,7-diol (PubChem CID 135511237) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-methylisoquinoline-6,7-diol.
Molecular Properties
| Compound Name | 1-methylisoquinoline-6,7-diol |
| PubChem CID | 135511237 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1-methylisoquinoline-6,7-diol |
| SMILES | Cc1nccc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C10H9NO2/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6/h2-5,12-13H,1H3 |
| InChIKey | ZHJMCJIZYGTPMH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-methylisoquinoline-6,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylisoquinoline-6,7-diol?
The IUPAC name of 1-methylisoquinoline-6,7-diol (CID 135511237) is 1-methylisoquinoline-6,7-diol.
What is the SMILES notation for 1-methylisoquinoline-6,7-diol?
The canonical SMILES for 1-methylisoquinoline-6,7-diol is Cc1nccc2cc(O)c(O)cc12.
What is the InChIKey of 1-methylisoquinoline-6,7-diol?
The InChIKey is ZHJMCJIZYGTPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-6-8-5-10(13)9(12)4-7(8)2-3-11-6/h2-5,12-13H,1H3.
What are the key properties of 1-methylisoquinoline-6,7-diol?
1-methylisoquinoline-6,7-diol has a molecular weight of 175.19 g/mol, XLogP of 1.95, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylisoquinoline-6,7-diol is sourced from PubChem (CID 135511237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).