C33H50N2O2 — CID 135511714
2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol (PubChem CID 135511714) has the molecular formula C33H50N2O2 and a molecular weight of 506.78 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol |
|---|---|
| PubChem CID | 135511714 |
| Molecular Formula | C33H50N2O2 |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.39 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/CCC/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H50N2O2/c1-30(2,3)24-16-22(28(36)26(18-24)32(7,8)9)20-34-14-13-15-35-21-23-17-25(31(4,5)6)19-27(29(23)37)33(10,11)12/h16-21,36-37H,13-15H2,1-12H3/b34-20+,35-21+ |
| InChIKey | DOLVFFGLNYMIPV-VQGAUUQYSA-N |
| XLogP | 8.22 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|