C16H22N2O2S — CID 135511901
3-(3,5-ditert-butyl-4-hydroxyphenyl)-2H-1,2,4-oxadiazole-5-thione (PubChem CID 135511901) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 135511901 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2H-1,2,4-oxadiazole-5-thione |
| SMILES | CC(C)(C)c1cc(-c2nc(=S)o[nH]2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C16H22N2O2S/c1-15(2,3)10-7-9(13-17-14(21)20-18-13)8-11(12(10)19)16(4,5)6/h7-8,19H,1-6H3,(H,17,18,21) |
| InChIKey | SAQAIDZOALKIMJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|