C15H11F3N2O3 — CID 135511929
4-[6-hydroxy-1-(2,2,2-trifluoroethyl)indazol-3-yl]benzene-1,3-diol (PubChem CID 135511929) has the molecular formula C15H11F3N2O3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 4-[6-hydroxy-1-(2,2,2-trifluoroethyl)indazol-3-yl]benzene-1,3-diol.
| Compound Name | 4-[6-hydroxy-1-(2,2,2-trifluoroethyl)indazol-3-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135511929 |
| Molecular Formula | C15H11F3N2O3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-[6-hydroxy-1-(2,2,2-trifluoroethyl)indazol-3-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2nn(CC(F)(F)F)c3cc(O)ccc23)c(O)c1 |
| InChI | InChI=1S/C15H11F3N2O3/c16-15(17,18)7-20-12-5-8(21)1-3-10(12)14(19-20)11-4-2-9(22)6-13(11)23/h1-6,21-23H,7H2 |
| InChIKey | YUMVZGGRPJTXIJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |