C22H30O4 — CID 135511991
(3R,5S,7R)-10-hydroxy-4,4,7-trimethyl-9-(2-methylbutanoyl)-3-prop-1-en-2-yltricyclo[5.3.1.01,5]undec-9-ene-8,11-dione (PubChem CID 135511991) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3R,5S,7R)-10-hydroxy-4,4,7-trimethyl-9-(2-methylbutanoyl)-3-prop-1-en-2-yltricyclo[5.3.1.01,5]undec-9-ene-8,11-dione.
| Compound Name | (3R,5S,7R)-10-hydroxy-4,4,7-trimethyl-9-(2-methylbutanoyl)-3-prop-1-en-2-yltricyclo[5.3.1.01,5]undec-9-ene-8,11-dione |
|---|---|
| PubChem CID | 135511991 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (3R,5S,7R)-10-hydroxy-4,4,7-trimethyl-9-(2-methylbutanoyl)-3-prop-1-en-2-yltricyclo[5.3.1.01,5]undec-9-ene-8,11-dione |
| SMILES | C=C(C)[C@H]1CC23C(=O)[C@@](C)(C[C@H]2C1(C)C)C(=O)C(C(=O)C(C)CC)=C3O |
| InChI | InChI=1S/C22H30O4/c1-8-12(4)16(23)15-17(24)21(7)10-14-20(5,6)13(11(2)3)9-22(14,18(15)25)19(21)26/h12-14,25H,2,8-10H2,1,3-7H3/t12?,13-,14+,21+,22?/m1/s1 |
| InChIKey | TZUMPSGMPXZTHQ-GEGSLOLFSA-N |
| XLogP | 4.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|