C16H14Cl3N5O — CID 135512058
(10R)-10-ethyl-5-methyl-2-(2,3,5-trichlorophenyl)-1,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),7-trien-6-one (PubChem CID 135512058) has the molecular formula C16H14Cl3N5O and a molecular weight of 398.68 g/mol. Its IUPAC name is (10R)-10-ethyl-5-methyl-2-(2,3,5-trichlorophenyl)-1,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),7-trien-6-one.
| Compound Name | (10R)-10-ethyl-5-methyl-2-(2,3,5-trichlorophenyl)-1,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),7-trien-6-one |
|---|---|
| PubChem CID | 135512058 |
| Molecular Formula | C16H14Cl3N5O |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | (10R)-10-ethyl-5-methyl-2-(2,3,5-trichlorophenyl)-1,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),7-trien-6-one |
| SMILES | CC[C@@H]1Cn2c(-c3cc(Cl)cc(Cl)c3Cl)nc3c2c(nc(=O)n3C)N1 |
| InChI | InChI=1S/C16H14Cl3N5O/c1-3-8-6-24-12-13(20-8)21-16(25)23(2)15(12)22-14(24)9-4-7(17)5-10(18)11(9)19/h4-5,8H,3,6H2,1-2H3,(H,20,21,25)/t8-/m1/s1 |
| InChIKey | UEBPCBTYBWNEJZ-MRVPVSSYSA-N |
| XLogP | 3.96 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|