C19H20ClN3O2 — CID 135512252
2-[1-[2-(4-chlorophenoxy)ethyl-methylamino]ethyl]-3H-quinazolin-4-one (PubChem CID 135512252) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 2-[1-[2-(4-chlorophenoxy)ethyl-methylamino]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[1-[2-(4-chlorophenoxy)ethyl-methylamino]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135512252 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[1-[2-(4-chlorophenoxy)ethyl-methylamino]ethyl]-3H-quinazolin-4-one |
| SMILES | CC(c1nc2ccccc2c(=O)[nH]1)N(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-13(18-21-17-6-4-3-5-16(17)19(24)22-18)23(2)11-12-25-15-9-7-14(20)8-10-15/h3-10,13H,11-12H2,1-2H3,(H,21,22,24) |
| InChIKey | XGIAWOBGAUDYKE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |