About 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one
1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135512365) has the molecular formula C14H12F3N5O
and a molecular weight of 323.28 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one.
Molecular Properties
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one |
| PubChem CID | 135512365 |
| Molecular Formula | C14H12F3N5O |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1cc(C)nc(-n2nc(C)c3c(C(F)(F)F)cc(=O)[nH]c32)n1 |
| InChI | InChI=1S/C14H12F3N5O/c1-6-4-7(2)19-13(18-6)22-12-11(8(3)21-22)9(14(15,16)17)5-10(23)20-12/h4-5H,1-3H3,(H,20,23) |
| InChIKey | XKWQQHVZYMRZNN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one?
The IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one (CID 135512365) is 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one.
What is the SMILES notation for 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one?
The canonical SMILES for 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one is Cc1cc(C)nc(-n2nc(C)c3c(C(F)(F)F)cc(=O)[nH]c32)n1.
What is the InChIKey of 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one?
The InChIKey is XKWQQHVZYMRZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N5O/c1-6-4-7(2)19-13(18-6)22-12-11(8(3)21-22)9(14(15,16)17)5-10(23)20-12/h4-5H,1-3H3,(H,20,23).
What are the key properties of 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one?
1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one has a molecular weight of 323.28 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethylpyrimidin-2-yl)-3-methyl-4-(trifluoromethyl)-7H-pyrazolo[5,4-b]pyridin-6-one is sourced from PubChem (CID 135512365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).