C12H15N3S — CID 135512399
N-ethyl-5-(4-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135512399) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-ethyl-5-(4-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-ethyl-5-(4-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135512399 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-ethyl-5-(4-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CC/N=C1/NN=C(c2ccc(C)cc2)CS1 |
| InChI | InChI=1S/C12H15N3S/c1-3-13-12-15-14-11(8-16-12)10-6-4-9(2)5-7-10/h4-7H,3,8H2,1-2H3,(H,13,15) |
| InChIKey | BRGRGPPMJJSGBO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|