C13H18ClN3O — CID 135512401
2-[(E)-(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenol;hydrochloride (PubChem CID 135512401) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-[(E)-(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenol;hydrochloride.
| Compound Name | 2-[(E)-(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 135512401 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[(E)-(3,4,5,6-tetrahydro-2H-azepin-7-ylhydrazinylidene)methyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccccc1/C=N/NC1=NCCCCC1 |
| InChI | InChI=1S/C13H17N3O.ClH/c17-12-7-4-3-6-11(12)10-15-16-13-8-2-1-5-9-14-13;/h3-4,6-7,10,17H,1-2,5,8-9H2,(H,14,16);1H/b15-10+; |
| InChIKey | KCPJEXLEHYGFJA-GYVLLFFHSA-N |
| XLogP | 2.71 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|