C20H35NO7Si — CID 135512566
methyl (E)-2-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboximidoyl]-3-hydroxybut-2-enoate (PubChem CID 135512566) has the molecular formula C20H35NO7Si and a molecular weight of 429.59 g/mol. Its IUPAC name is methyl (E)-2-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboximidoyl]-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboximidoyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135512566 |
| Molecular Formula | C20H35NO7Si |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | methyl (E)-2-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboximidoyl]-3-hydroxybut-2-enoate |
| SMILES | [H]/N=C(C(\C(=O)OC)=C(\C)O)/[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H35NO7Si/c1-11(22)13(18(23)24-7)14(21)16-17-15(27-20(5,6)28-17)12(26-16)10-25-29(8,9)19(2,3)4/h12,15-17,21-22H,10H2,1-9H3/b13-11+,21-14+/t12-,15-,16+,17-/m1/s1 |
| InChIKey | KJYXYJWBGVMXPK-PWWHFPOISA-N |
| XLogP | 3.32 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|