C18H20N6 — CID 135512751
5-hexyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine (PubChem CID 135512751) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-hexyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine.
| Compound Name | 5-hexyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine |
|---|---|
| PubChem CID | 135512751 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 5-hexyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine |
| SMILES | CCCCCCc1nc2nc[nH]c2c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C18H20N6/c1-2-3-4-8-11-14-21-17-15(19-12-20-17)18-22-16(23-24(14)18)13-9-6-5-7-10-13/h5-7,9-10,12H,2-4,8,11H2,1H3,(H,19,20) |
| InChIKey | FXPQXNWVRJVPNB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|