C13H12F4N2OS — CID 135513268
(5S)-2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one (PubChem CID 135513268) has the molecular formula C13H12F4N2OS and a molecular weight of 320.31 g/mol. Its IUPAC name is (5S)-2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one.
| Compound Name | (5S)-2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135513268 |
| Molecular Formula | C13H12F4N2OS |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (5S)-2-[(1S)-1-(2-fluorophenyl)ethyl]imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
| SMILES | C[C@H](/N=C1\NC(=O)[C@@](C)(C(F)(F)F)S1)c1ccccc1F |
| InChI | InChI=1S/C13H12F4N2OS/c1-7(8-5-3-4-6-9(8)14)18-11-19-10(20)12(2,21-11)13(15,16)17/h3-7H,1-2H3,(H,18,19,20)/t7-,12-/m0/s1 |
| InChIKey | KNHNFKZUNFPPQE-MADCSZMMSA-N |
| XLogP | 3.43 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|