C17H23NO — CID 135513792
2-[[(1S,2S)-2-cyclopentylcyclopentyl]iminomethyl]phenol (PubChem CID 135513792) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-cyclopentylcyclopentyl]iminomethyl]phenol.
| Compound Name | 2-[[(1S,2S)-2-cyclopentylcyclopentyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135513792 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-[[(1S,2S)-2-cyclopentylcyclopentyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/[C@H]1CCC[C@H]1C1CCCC1 |
| InChI | InChI=1S/C17H23NO/c19-17-11-4-3-8-14(17)12-18-16-10-5-9-15(16)13-6-1-2-7-13/h3-4,8,11-13,15-16,19H,1-2,5-7,9-10H2/b18-12+/t15-,16-/m0/s1 |
| InChIKey | CERMOGQPKNDSJZ-COGMNKOPSA-N |
| XLogP | 4.17 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|