C9H6F4N4O2 — CID 135513824
4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-tetrazol-5-one (PubChem CID 135513824) has the molecular formula C9H6F4N4O2 and a molecular weight of 278.17 g/mol. Its IUPAC name is 4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-tetrazol-5-one.
| Compound Name | 4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-tetrazol-5-one |
|---|---|
| PubChem CID | 135513824 |
| Molecular Formula | C9H6F4N4O2 |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-tetrazol-5-one |
| SMILES | O=c1[nH]nnn1-c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C9H6F4N4O2/c10-7(11)9(12,13)19-6-3-1-5(2-4-6)17-8(18)14-15-16-17/h1-4,7H,(H,14,16,18) |
| InChIKey | KOBGQMYVGDSBGF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|