C12H10N6OS — CID 135513833
[(E)-(9-oxo-1H-pyrazolo[5,1-b]quinazolin-3-yl)methylideneamino]thiourea (PubChem CID 135513833) has the molecular formula C12H10N6OS and a molecular weight of 286.32 g/mol. Its IUPAC name is [(E)-(9-oxo-1H-pyrazolo[5,1-b]quinazolin-3-yl)methylideneamino]thiourea.
| Compound Name | [(E)-(9-oxo-1H-pyrazolo[5,1-b]quinazolin-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135513833 |
| Molecular Formula | C12H10N6OS |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | [(E)-(9-oxo-1H-pyrazolo[5,1-b]quinazolin-3-yl)methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1c[nH]n2c(=O)c3ccccc3nc12 |
| InChI | InChI=1S/C12H10N6OS/c13-12(20)17-14-5-7-6-15-18-10(7)16-9-4-2-1-3-8(9)11(18)19/h1-6,15H,(H3,13,17,20)/b14-5+ |
| InChIKey | PRIRHYXSKAOTLR-LHHJGKSTSA-N |
| XLogP | 0.34 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|