C17H20N6O2S — CID 135513970
[3-(1,3-dimethyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-4-propoxyphenyl]thiourea (PubChem CID 135513970) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is [3-(1,3-dimethyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-4-propoxyphenyl]thiourea.
| Compound Name | [3-(1,3-dimethyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-4-propoxyphenyl]thiourea |
|---|---|
| PubChem CID | 135513970 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [3-(1,3-dimethyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)-4-propoxyphenyl]thiourea |
| SMILES | CCCOc1ccc(NC(N)=S)cc1-c1nc2c(c(C)nn2C)c(=O)[nH]1 |
| InChI | InChI=1S/C17H20N6O2S/c1-4-7-25-12-6-5-10(19-17(18)26)8-11(12)14-20-15-13(16(24)21-14)9(2)22-23(15)3/h5-6,8H,4,7H2,1-3H3,(H3,18,19,26)(H,20,21,24) |
| InChIKey | NOPBWPLSUBLPKN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|