About 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide
5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide (PubChem CID 135514082) has the molecular formula C9H9Br2N3S
and a molecular weight of 351.07 g/mol. Its IUPAC name is 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide |
| PubChem CID | 135514082 |
| Molecular Formula | C9H9Br2N3S |
| Molecular Weight | 351.07 g/mol |
| Exact Mass | 348.89 |
| IUPAC Name | 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide |
| SMILES | NC1=[NH+]N=C(c2ccc(Br)cc2)CS1.[Br-] |
| InChI | InChI=1S/C9H8BrN3S.BrH/c10-7-3-1-6(2-4-7)8-5-14-9(11)13-12-8;/h1-4H,5H2,(H2,11,13);1H |
| InChIKey | JZYYCQBZYNFZPK-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 52.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.07 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide?
The IUPAC name of 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide (CID 135514082) is 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide.
What is the SMILES notation for 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide?
The canonical SMILES for 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide is NC1=[NH+]N=C(c2ccc(Br)cc2)CS1.[Br-].
What is the InChIKey of 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide?
The InChIKey is JZYYCQBZYNFZPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3S.BrH/c10-7-3-1-6(2-4-7)8-5-14-9(11)13-12-8;/h1-4H,5H2,(H2,11,13);1H.
What are the key properties of 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide?
5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide has a molecular weight of 351.07 g/mol, XLogP of -2.70, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-6H-1,3,4-thiadiazin-3-ium-2-amine bromide is sourced from PubChem (CID 135514082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).