C14H23N3OS — CID 135514272
(NZ)-N-[3-ethyl-6-(2-ethylsulfanylpropyl)-1,5,6,7-tetrahydroindazol-4-ylidene]hydroxylamine (PubChem CID 135514272) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is (NZ)-N-[3-ethyl-6-(2-ethylsulfanylpropyl)-1,5,6,7-tetrahydroindazol-4-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[3-ethyl-6-(2-ethylsulfanylpropyl)-1,5,6,7-tetrahydroindazol-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135514272 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (NZ)-N-[3-ethyl-6-(2-ethylsulfanylpropyl)-1,5,6,7-tetrahydroindazol-4-ylidene]hydroxylamine |
| SMILES | CCSC(C)CC1C/C(=N/O)c2c(CC)n[nH]c2C1 |
| InChI | InChI=1S/C14H23N3OS/c1-4-11-14-12(16-15-11)7-10(8-13(14)17-18)6-9(3)19-5-2/h9-10,18H,4-8H2,1-3H3,(H,15,16)/b17-13- |
| InChIKey | BSQKBUQYHPUISC-LGMDPLHJSA-N |
| XLogP | 3.24 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|