C24H32N6O — CID 135514465
9-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)butyl]-2-anilino-1H-purin-6-one (PubChem CID 135514465) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 9-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)butyl]-2-anilino-1H-purin-6-one.
| Compound Name | 9-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)butyl]-2-anilino-1H-purin-6-one |
|---|---|
| PubChem CID | 135514465 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 9-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)butyl]-2-anilino-1H-purin-6-one |
| SMILES | O=c1[nH]c(Nc2ccccc2)nc2c1ncn2CCCCN1CCCC2CCCCC21 |
| InChI | InChI=1S/C24H32N6O/c31-23-21-22(27-24(28-23)26-19-11-2-1-3-12-19)30(17-25-21)15-7-6-14-29-16-8-10-18-9-4-5-13-20(18)29/h1-3,11-12,17-18,20H,4-10,13-16H2,(H2,26,27,28,31) |
| InChIKey | WHNWGLBSXQAFNX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|