C26H19Cl2N5O5S — CID 135514501
ethyl 2-[3-[[5-(3,5-dichloro-2-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]carbamoylamino]-9-oxoacridin-10-yl]acetate (PubChem CID 135514501) has the molecular formula C26H19Cl2N5O5S and a molecular weight of 584.44 g/mol. Its IUPAC name is ethyl 2-[3-[[5-(3,5-dichloro-2-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]carbamoylamino]-9-oxoacridin-10-yl]acetate.
| Compound Name | ethyl 2-[3-[[5-(3,5-dichloro-2-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]carbamoylamino]-9-oxoacridin-10-yl]acetate |
|---|---|
| PubChem CID | 135514501 |
| Molecular Formula | C26H19Cl2N5O5S |
| Molecular Weight | 584.44 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | ethyl 2-[3-[[5-(3,5-dichloro-2-hydroxyphenyl)-1,3,4-thiadiazol-2-yl]carbamoylamino]-9-oxoacridin-10-yl]acetate |
| SMILES | CCOC(=O)Cn1c2ccccc2c(=O)c2ccc(NC(=O)Nc3nnc(-c4cc(Cl)cc(Cl)c4O)s3)cc21 |
| InChI | InChI=1S/C26H19Cl2N5O5S/c1-2-38-21(34)12-33-19-6-4-3-5-15(19)22(35)16-8-7-14(11-20(16)33)29-25(37)30-26-32-31-24(39-26)17-9-13(27)10-18(28)23(17)36/h3-11,36H,2,12H2,1H3,(H2,29,30,32,37) |
| InChIKey | CIBKFWBHQTWGKC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|