C9H16N5O13P3 — CID 135514618
[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 135514618) has the molecular formula C9H16N5O13P3 and a molecular weight of 495.17 g/mol. Its IUPAC name is [[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 135514618 |
| Molecular Formula | C9H16N5O13P3 |
| Molecular Weight | 495.17 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | [[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2COC(CO)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H16N5O13P3/c10-9-12-7-6(8(16)13-9)11-3-14(7)4-24-5(1-15)2-25-29(20,21)27-30(22,23)26-28(17,18)19/h3,5,15H,1-2,4H2,(H,20,21)(H,22,23)(H2,17,18,19)(H3,10,12,13,16) |
| InChIKey | OBABDJMYPMAQEP-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 278.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.17 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|