C44H31N7O2 — CID 135514702
[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenyl] propanoate (PubChem CID 135514702) has the molecular formula C44H31N7O2 and a molecular weight of 689.78 g/mol. Its IUPAC name is [4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenyl] propanoate.
| Compound Name | [4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenyl] propanoate |
|---|---|
| PubChem CID | 135514702 |
| Molecular Formula | C44H31N7O2 |
| Molecular Weight | 689.78 g/mol |
| Exact Mass | 689.25 |
| IUPAC Name | [4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccncc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H31N7O2/c1-2-40(52)53-31-5-3-27(4-6-31)41-32-7-9-34(48-32)42(28-15-21-45-22-16-28)36-11-13-38(50-36)44(30-19-25-47-26-20-30)39-14-12-37(51-39)43(29-17-23-46-24-18-29)35-10-8-33(41)49-35/h3-26,48,51H,2H2,1H3/b41-32-,41-33-,42-34-,42-36-,43-35-,43-37-,44-38-,44-39- |
| InChIKey | LQTWPMQMDYWDOA-HPTRPRHPSA-N |
| XLogP | 9.82 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.78 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|