C9H5ClN6O — CID 135515017
6-(4-chlorophenyl)-8H-tetrazolo[1,5-b][1,2,4]triazin-7-one (PubChem CID 135515017) has the molecular formula C9H5ClN6O and a molecular weight of 248.63 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-8H-tetrazolo[1,5-b][1,2,4]triazin-7-one.
| Compound Name | 6-(4-chlorophenyl)-8H-tetrazolo[1,5-b][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 135515017 |
| Molecular Formula | C9H5ClN6O |
| Molecular Weight | 248.63 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 6-(4-chlorophenyl)-8H-tetrazolo[1,5-b][1,2,4]triazin-7-one |
| SMILES | O=c1[nH]c2nnnn2nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H5ClN6O/c10-6-3-1-5(2-4-6)7-8(17)11-9-12-14-15-16(9)13-7/h1-4H,(H,11,12,15,17) |
| InChIKey | ORRHUIPQIOBMRI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.63 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |