C18H22N4O4 — CID 135515077
ethyl 7-(3,4-dimethoxyphenyl)-2,5-dimethyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135515077) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is ethyl 7-(3,4-dimethoxyphenyl)-2,5-dimethyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(3,4-dimethoxyphenyl)-2,5-dimethyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135515077 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | ethyl 7-(3,4-dimethoxyphenyl)-2,5-dimethyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(C)nn2C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H22N4O4/c1-6-26-17(23)15-10(2)19-18-20-11(3)21-22(18)16(15)12-7-8-13(24-4)14(9-12)25-5/h7-9,16H,6H2,1-5H3,(H,19,20,21) |
| InChIKey | LWYYAIZHIPPADL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |