C23H23N5O2S2 — CID 135515217
(2Z)-3-(4-methoxyphenyl)-2-[(E)-1-[5-methyl-3-(4-methylphenyl)-2-sulfanylidene-1H-imidazol-4-yl]ethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135515217) has the molecular formula C23H23N5O2S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is (2Z)-3-(4-methoxyphenyl)-2-[(E)-1-[5-methyl-3-(4-methylphenyl)-2-sulfanylidene-1H-imidazol-4-yl]ethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-(4-methoxyphenyl)-2-[(E)-1-[5-methyl-3-(4-methylphenyl)-2-sulfanylidene-1H-imidazol-4-yl]ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135515217 |
| Molecular Formula | C23H23N5O2S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (2Z)-3-(4-methoxyphenyl)-2-[(E)-1-[5-methyl-3-(4-methylphenyl)-2-sulfanylidene-1H-imidazol-4-yl]ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)CS/C2=N\N=C(/C)c2c(C)[nH]c(=S)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23N5O2S2/c1-14-5-7-18(8-6-14)28-21(15(2)24-22(28)31)16(3)25-26-23-27(20(29)13-32-23)17-9-11-19(30-4)12-10-17/h5-12H,13H2,1-4H3,(H,24,31)/b25-16+,26-23- |
| InChIKey | ZQCAEHXUXPTOIN-IYLGLBRYSA-N |
| XLogP | 5.02 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|