About CID 135515521
CID 135515521 (PubChem CID 135515521) has the molecular formula C17H15N3Na2O6
and a molecular weight of 403.30 g/mol.
Molecular Properties
| Compound Name | CID 135515521 |
| PubChem CID | 135515521 |
| Molecular Formula | C17H15N3Na2O6 |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | — |
| SMILES | O=C(O)CCNC(=O)c1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1.[Na].[Na] |
| InChI | InChI=1S/C17H15N3O6.2Na/c21-14-6-5-12(9-13(14)17(25)26)20-19-11-3-1-10(2-4-11)16(24)18-8-7-15(22)23;;/h1-6,9,21H,7-8H2,(H,18,24)(H,22,23)(H,25,26);;/b20-19+;; |
| InChIKey | WLYZKTXOAMAVEO-LLIZZRELSA-N |
| XLogP | 1.95 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze CID 135515521 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135515521?
The IUPAC name of CID 135515521 (CID 135515521) is not available.
What is the SMILES notation for CID 135515521?
The canonical SMILES for CID 135515521 is O=C(O)CCNC(=O)c1ccc(/N=N/c2ccc(O)c(C(=O)O)c2)cc1.[Na].[Na].
What is the InChIKey of CID 135515521?
The InChIKey is WLYZKTXOAMAVEO-LLIZZRELSA-N. The full InChI is InChI=1S/C17H15N3O6.2Na/c21-14-6-5-12(9-13(14)17(25)26)20-19-11-3-1-10(2-4-11)16(24)18-8-7-15(22)23;;/h1-6,9,21H,7-8H2,(H,18,24)(H,22,23)(H,25,26);;/b20-19+;;.
What are the key properties of CID 135515521?
CID 135515521 has a molecular weight of 403.30 g/mol, XLogP of 1.95, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135515521 is sourced from PubChem (CID 135515521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).