C16H9Br2IN2O2S — CID 135515725
5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2-(3-bromophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135515725) has the molecular formula C16H9Br2IN2O2S and a molecular weight of 580.04 g/mol. Its IUPAC name is 5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2-(3-bromophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2-(3-bromophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135515725 |
| Molecular Formula | C16H9Br2IN2O2S |
| Molecular Weight | 580.04 g/mol |
| Exact Mass | 577.78 |
| IUPAC Name | 5-[(3-bromo-4-hydroxy-5-iodophenyl)methylidene]-2-(3-bromophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cccc(Br)c2)SC1=Cc1cc(Br)c(O)c(I)c1 |
| InChI | InChI=1S/C16H9Br2IN2O2S/c17-9-2-1-3-10(7-9)20-16-21-15(23)13(24-16)6-8-4-11(18)14(22)12(19)5-8/h1-7,22H,(H,20,21,23) |
| InChIKey | MHBADCSWYVNOOM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.04 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|