C21H29N3O — CID 135516039
2-(diethylaminomethyl)-5,5-diethyl-3,6-dihydrobenzo[h]quinazolin-4-one (PubChem CID 135516039) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-5,5-diethyl-3,6-dihydrobenzo[h]quinazolin-4-one.
| Compound Name | 2-(diethylaminomethyl)-5,5-diethyl-3,6-dihydrobenzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 135516039 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 2-(diethylaminomethyl)-5,5-diethyl-3,6-dihydrobenzo[h]quinazolin-4-one |
| SMILES | CCN(CC)Cc1nc2c(c(=O)[nH]1)C(CC)(CC)Cc1ccccc1-2 |
| InChI | InChI=1S/C21H29N3O/c1-5-21(6-2)13-15-11-9-10-12-16(15)19-18(21)20(25)23-17(22-19)14-24(7-3)8-4/h9-12H,5-8,13-14H2,1-4H3,(H,22,23,25) |
| InChIKey | NSGYIRUDWOZKRF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |