C13H12FN3O2S — CID 135516103
4-amino-2-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 135516103) has the molecular formula C13H12FN3O2S and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-amino-2-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135516103 |
| Molecular Formula | C13H12FN3O2S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-amino-2-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(C(=O)CSc2nc(N)cc(=O)[nH]2)ccc1F |
| InChI | InChI=1S/C13H12FN3O2S/c1-7-4-8(2-3-9(7)14)10(18)6-20-13-16-11(15)5-12(19)17-13/h2-5H,6H2,1H3,(H3,15,16,17,19) |
| InChIKey | FVGCUAPLWKULTE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |