C15H8Cl2FN3O — CID 135516292
3-(2,4-dichlorophenyl)-6-(4-fluorophenyl)-4H-1,2,4-triazin-5-one (PubChem CID 135516292) has the molecular formula C15H8Cl2FN3O and a molecular weight of 336.15 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-6-(4-fluorophenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2,4-dichlorophenyl)-6-(4-fluorophenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135516292 |
| Molecular Formula | C15H8Cl2FN3O |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-6-(4-fluorophenyl)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2Cl)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H8Cl2FN3O/c16-9-3-6-11(12(17)7-9)14-19-15(22)13(20-21-14)8-1-4-10(18)5-2-8/h1-7H,(H,19,21,22) |
| InChIKey | YMADQHTVBBHDKT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |