C15H9N2O3- — CID 135516462
3-[(2-oxo-1H-indol-3-ylidene)amino]benzoate (PubChem CID 135516462) has the molecular formula C15H9N2O3- and a molecular weight of 265.25 g/mol. Its IUPAC name is 3-[(2-oxo-1H-indol-3-ylidene)amino]benzoate.
| Compound Name | 3-[(2-oxo-1H-indol-3-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 135516462 |
| Molecular Formula | C15H9N2O3- |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-[(2-oxo-1H-indol-3-ylidene)amino]benzoate |
| SMILES | O=C1Nc2ccccc2/C1=N/c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C15H10N2O3/c18-14-13(11-6-1-2-7-12(11)17-14)16-10-5-3-4-9(8-10)15(19)20/h1-8H,(H,19,20)(H,16,17,18)/p-1 |
| InChIKey | JULSJJGHGVMLOI-UHFFFAOYSA-M |
| XLogP | 1.12 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|