About 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one
1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one (PubChem CID 135516517) has the molecular formula C25H22N4O
and a molecular weight of 394.48 g/mol. Its IUPAC name is 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one.
Molecular Properties
| Compound Name | 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one |
| PubChem CID | 135516517 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one |
| SMILES | O=c1nc2c(cn1Cc1ccccc1)N(Cc1ccccc1)C(c1ccccc1)N2 |
| InChI | InChI=1S/C25H22N4O/c30-25-27-23-22(18-28(25)16-19-10-4-1-5-11-19)29(17-20-12-6-2-7-13-20)24(26-23)21-14-8-3-9-15-21/h1-15,18,24H,16-17H2,(H,26,27,30) |
| InChIKey | YLKNQQWWQZOUPO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one?
The IUPAC name of 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one (CID 135516517) is 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one.
What is the SMILES notation for 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one?
The canonical SMILES for 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one is O=c1nc2c(cn1Cc1ccccc1)N(Cc1ccccc1)C(c1ccccc1)N2.
What is the InChIKey of 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one?
The InChIKey is YLKNQQWWQZOUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N4O/c30-25-27-23-22(18-28(25)16-19-10-4-1-5-11-19)29(17-20-12-6-2-7-13-20)24(26-23)21-14-8-3-9-15-21/h1-15,18,24H,16-17H2,(H,26,27,30).
What are the key properties of 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one?
1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one has a molecular weight of 394.48 g/mol, XLogP of 4.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dibenzyl-8-phenyl-8,9-dihydropurin-2-one is sourced from PubChem (CID 135516517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).