C19H20N2O4 — CID 135517042
(2E)-2-benzylidene-4-hydroxy-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]butanamide (PubChem CID 135517042) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2E)-2-benzylidene-4-hydroxy-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]butanamide.
| Compound Name | (2E)-2-benzylidene-4-hydroxy-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 135517042 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2E)-2-benzylidene-4-hydroxy-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]butanamide |
| SMILES | COc1cc(/C=N/NC(=O)/C(=C/c2ccccc2)CCO)ccc1O |
| InChI | InChI=1S/C19H20N2O4/c1-25-18-12-15(7-8-17(18)23)13-20-21-19(24)16(9-10-22)11-14-5-3-2-4-6-14/h2-8,11-13,22-23H,9-10H2,1H3,(H,21,24)/b16-11+,20-13+ |
| InChIKey | RKBLWHATUCKSIA-NWDFCGOISA-N |
| XLogP | 2.32 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|