C15H18N4O2 — CID 135517054
3-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 135517054) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135517054 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | Cc1cc(C)n(CCC(=O)N/N=C/c2ccccc2O)n1 |
| InChI | InChI=1S/C15H18N4O2/c1-11-9-12(2)19(18-11)8-7-15(21)17-16-10-13-5-3-4-6-14(13)20/h3-6,9-10,20H,7-8H2,1-2H3,(H,17,21)/b16-10+ |
| InChIKey | FIOPZCORJSNENW-MHWRWJLKSA-N |
| XLogP | 1.75 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|